C16H16NO2S- — CID 88643076
2-(2,4-dimethyl-3-oxido-4H-1,3-benzothiazin-2-yl)phenol (PubChem CID 88643076) has the molecular formula C16H16NO2S- and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-(2,4-dimethyl-3-oxido-4H-1,3-benzothiazin-2-yl)phenol.
| Compound Name | 2-(2,4-dimethyl-3-oxido-4H-1,3-benzothiazin-2-yl)phenol |
|---|---|
| PubChem CID | 88643076 |
| Molecular Formula | C16H16NO2S- |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-(2,4-dimethyl-3-oxido-4H-1,3-benzothiazin-2-yl)phenol |
| SMILES | CC1c2ccccc2SC(C)(c2ccccc2O)N1[O-] |
| InChI | InChI=1S/C16H16NO2S/c1-11-12-7-3-6-10-15(12)20-16(2,17(11)19)13-8-4-5-9-14(13)18/h3-11,18H,1-2H3/q-1 |
| InChIKey | IKSMXESLPFBTGT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|