C14H18OS — CID 101222026
(2R,3aR,9bR)-2,4,4-trimethyl-2,3,3a,9b-tetrahydrothiochromeno[4,3-b]furan (PubChem CID 101222026) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is (2R,3aR,9bR)-2,4,4-trimethyl-2,3,3a,9b-tetrahydrothiochromeno[4,3-b]furan.
| Compound Name | (2R,3aR,9bR)-2,4,4-trimethyl-2,3,3a,9b-tetrahydrothiochromeno[4,3-b]furan |
|---|---|
| PubChem CID | 101222026 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (2R,3aR,9bR)-2,4,4-trimethyl-2,3,3a,9b-tetrahydrothiochromeno[4,3-b]furan |
| SMILES | C[C@@H]1C[C@@H]2[C@@H](O1)c1ccccc1SC2(C)C |
| InChI | InChI=1S/C14H18OS/c1-9-8-11-13(15-9)10-6-4-5-7-12(10)16-14(11,2)3/h4-7,9,11,13H,8H2,1-3H3/t9-,11-,13+/m1/s1 |
| InChIKey | NFAYKIKMNHVWOY-XWIASGKRSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |