C11H14 — CID 143951833
(3S)-1,3-dimethyl-2,3-dihydro-1H-indene (PubChem CID 143951833) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is (3S)-1,3-dimethyl-2,3-dihydro-1H-indene.
| Compound Name | (3S)-1,3-dimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 143951833 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (3S)-1,3-dimethyl-2,3-dihydro-1H-indene |
| SMILES | CC1C[C@H](C)c2ccccc21 |
| InChI | InChI=1S/C11H14/c1-8-7-9(2)11-6-4-3-5-10(8)11/h3-6,8-9H,7H2,1-2H3/t8-,9?/m0/s1 |
| InChIKey | IIJUYSSJMAITHJ-IENPIDJESA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |