C16H16 — CID 163676750
(1R)-1-methyl-3-phenyl-2,3-dihydro-1H-indene (PubChem CID 163676750) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1R)-1-methyl-3-phenyl-2,3-dihydro-1H-indene.
| Compound Name | (1R)-1-methyl-3-phenyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 163676750 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (1R)-1-methyl-3-phenyl-2,3-dihydro-1H-indene |
| SMILES | C[C@@H]1CC(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C16H16/c1-12-11-16(13-7-3-2-4-8-13)15-10-6-5-9-14(12)15/h2-10,12,16H,11H2,1H3/t12-,16?/m1/s1 |
| InChIKey | JHIDJKSBZPNVKZ-ZGTOLYCTSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |