C16H16O — CID 100969448
(2R,4R)-4-methyl-2-phenyl-3,4-dihydro-2H-chromene (PubChem CID 100969448) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is (2R,4R)-4-methyl-2-phenyl-3,4-dihydro-2H-chromene.
| Compound Name | (2R,4R)-4-methyl-2-phenyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 100969448 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (2R,4R)-4-methyl-2-phenyl-3,4-dihydro-2H-chromene |
| SMILES | C[C@@H]1C[C@H](c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C16H16O/c1-12-11-16(13-7-3-2-4-8-13)17-15-10-6-5-9-14(12)15/h2-10,12,16H,11H2,1H3/t12-,16-/m1/s1 |
| InChIKey | FEQVSCDUIDPJJD-MLGOLLRUSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |