C10H13N — CID 28502914
(1S,3S)-3-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 28502914) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (1S,3S)-3-methyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S,3S)-3-methyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 28502914 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (1S,3S)-3-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C[C@H]1C[C@H](N)c2ccccc21 |
| InChI | InChI=1S/C10H13N/c1-7-6-10(11)9-5-3-2-4-8(7)9/h2-5,7,10H,6,11H2,1H3/t7-,10-/m0/s1 |
| InChIKey | AAYKJFZVFFINFK-XVKPBYJWSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |