C12H16O — CID 100995671
(1S,2S,3R)-1,2,3-trimethyl-2,3-dihydroinden-1-ol (PubChem CID 100995671) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (1S,2S,3R)-1,2,3-trimethyl-2,3-dihydroinden-1-ol.
| Compound Name | (1S,2S,3R)-1,2,3-trimethyl-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 100995671 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (1S,2S,3R)-1,2,3-trimethyl-2,3-dihydroinden-1-ol |
| SMILES | C[C@H]1c2ccccc2[C@@](C)(O)[C@H]1C |
| InChI | InChI=1S/C12H16O/c1-8-9(2)12(3,13)11-7-5-4-6-10(8)11/h4-9,13H,1-3H3/t8-,9+,12+/m1/s1 |
| InChIKey | UOLYPCDTDAGXFW-PTRXPTGYSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |