About 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane
7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane (PubChem CID 159809006) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane.
Analyze 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane?
The IUPAC name of 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane (CID 159809006) is 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane.
What is the SMILES notation for 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane?
The canonical SMILES for 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane is CC.CC1c2ccccc2C1C.
What is the InChIKey of 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane?
The InChIKey is NKTVFYSQYHSBSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C2H6/c1-7-8(2)10-6-4-3-5-9(7)10;1-2/h3-8H,1-2H3;1-2H3.
What are the key properties of 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane?
7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane has a molecular weight of 162.28 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene;ethane is sourced from PubChem (CID 159809006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).