C13H21N — CID 91500184
ethane;1,2,3-trimethyl-2,3-dihydroindole (PubChem CID 91500184) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is ethane;1,2,3-trimethyl-2,3-dihydroindole.
| Compound Name | ethane;1,2,3-trimethyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 91500184 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | ethane;1,2,3-trimethyl-2,3-dihydroindole |
| SMILES | CC.CC1c2ccccc2N(C)C1C |
| InChI | InChI=1S/C11H15N.C2H6/c1-8-9(2)12(3)11-7-5-4-6-10(8)11;1-2/h4-9H,1-3H3;1-2H3 |
| InChIKey | VZGGPBNGBLZXJQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |