C13H19N — CID 161026697
2,3-dimethyl-1-propyl-2,3-dihydroindole (PubChem CID 161026697) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 2,3-dimethyl-1-propyl-2,3-dihydroindole.
| Compound Name | 2,3-dimethyl-1-propyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 161026697 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2,3-dimethyl-1-propyl-2,3-dihydroindole |
| SMILES | CCCN1c2ccccc2C(C)C1C |
| InChI | InChI=1S/C13H19N/c1-4-9-14-11(3)10(2)12-7-5-6-8-13(12)14/h5-8,10-11H,4,9H2,1-3H3 |
| InChIKey | ZLRCMTUSBPNRGH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |