C13H18N2O — CID 163155161
N-[(2S,3R)-2,3-dimethyl-2,3-dihydroindol-1-yl]propanamide (PubChem CID 163155161) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-[(2S,3R)-2,3-dimethyl-2,3-dihydroindol-1-yl]propanamide.
| Compound Name | N-[(2S,3R)-2,3-dimethyl-2,3-dihydroindol-1-yl]propanamide |
|---|---|
| PubChem CID | 163155161 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-[(2S,3R)-2,3-dimethyl-2,3-dihydroindol-1-yl]propanamide |
| SMILES | CCC(=O)NN1c2ccccc2[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C13H18N2O/c1-4-13(16)14-15-10(3)9(2)11-7-5-6-8-12(11)15/h5-10H,4H2,1-3H3,(H,14,16)/t9-,10-/m0/s1 |
| InChIKey | OVCGUTLZHAOTPL-UWVGGRQHSA-N |
| XLogP | 2.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |