C16H23NO2 — CID 91464048
2-(2-methyl-1-pentyl-2,3-dihydroindol-3-yl)acetic acid (PubChem CID 91464048) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-(2-methyl-1-pentyl-2,3-dihydroindol-3-yl)acetic acid.
| Compound Name | 2-(2-methyl-1-pentyl-2,3-dihydroindol-3-yl)acetic acid |
|---|---|
| PubChem CID | 91464048 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-(2-methyl-1-pentyl-2,3-dihydroindol-3-yl)acetic acid |
| SMILES | CCCCCN1c2ccccc2C(CC(=O)O)C1C |
| InChI | InChI=1S/C16H23NO2/c1-3-4-7-10-17-12(2)14(11-16(18)19)13-8-5-6-9-15(13)17/h5-6,8-9,12,14H,3-4,7,10-11H2,1-2H3,(H,18,19) |
| InChIKey | RDVNLNOHJOAZBH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|