2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid

C15H19NO3 — CID 79024077

IUPAC2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid
SMILESCCCCC(=O)N1CC(CC(=O)O)c2ccccc21
InChIInChI=1S/C15H19NO3/c1-2-3-8-14(17)16-10-11(9-15(18)19)12-6-4-5-7-13(12)16/h4-7,11H,2-3,8-10H2,1H3,(H,18,19)
InChIKeyZLFRICVAKHODSF-UHFFFAOYSA-N
MW261.32 g/mol
LogP2.78
Rot. Bonds5

About 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid

2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid (PubChem CID 79024077) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid.

Molecular Properties

Compound Name2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid
PubChem CID79024077
Molecular FormulaC15H19NO3
Molecular Weight261.32 g/mol
Exact Mass261.14
IUPAC Name2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid
SMILESCCCCC(=O)N1CC(CC(=O)O)c2ccccc21
InChIInChI=1S/C15H19NO3/c1-2-3-8-14(17)16-10-11(9-15(18)19)12-6-4-5-7-13(12)16/h4-7,11H,2-3,8-10H2,1H3,(H,18,19)
InChIKeyZLFRICVAKHODSF-UHFFFAOYSA-N
XLogP2.78
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.32
LogP ≤ 52.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid?
The IUPAC name of 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid (CID 79024077) is 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid.
What is the SMILES notation for 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid?
The canonical SMILES for 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid is CCCCC(=O)N1CC(CC(=O)O)c2ccccc21.
What is the InChIKey of 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid?
The InChIKey is ZLFRICVAKHODSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-2-3-8-14(17)16-10-11(9-15(18)19)12-6-4-5-7-13(12)16/h4-7,11H,2-3,8-10H2,1H3,(H,18,19).
What are the key properties of 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid?
2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid has a molecular weight of 261.32 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-pentanoyl-2,3-dihydroindol-3-yl)acetic acid is sourced from PubChem (CID 79024077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).