C17H24N4O2 — CID 174228482
(2S,3S,4S)-4-azido-1-ethyl-3-pentyl-3,4-dihydro-2H-quinoline-2-carboxylic acid (PubChem CID 174228482) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is (2S,3S,4S)-4-azido-1-ethyl-3-pentyl-3,4-dihydro-2H-quinoline-2-carboxylic acid.
| Compound Name | (2S,3S,4S)-4-azido-1-ethyl-3-pentyl-3,4-dihydro-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 174228482 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (2S,3S,4S)-4-azido-1-ethyl-3-pentyl-3,4-dihydro-2H-quinoline-2-carboxylic acid |
| SMILES | CCCCC[C@@H]1[C@H](N=[N+]=[N-])c2ccccc2N(CC)[C@@H]1C(=O)O |
| InChI | InChI=1S/C17H24N4O2/c1-3-5-6-10-13-15(19-20-18)12-9-7-8-11-14(12)21(4-2)16(13)17(22)23/h7-9,11,13,15-16H,3-6,10H2,1-2H3,(H,22,23)/t13-,15-,16+/m1/s1 |
| InChIKey | SHRNNXNOPZGZHS-BMFZPTHFSA-N |
| XLogP | 4.53 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|