C24H31NO — CID 102192645
2,2-dimethyl-1-[(2S,3R)-2-pentyl-3-phenyl-2,3-dihydroindol-1-yl]propan-1-one (PubChem CID 102192645) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(2S,3R)-2-pentyl-3-phenyl-2,3-dihydroindol-1-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[(2S,3R)-2-pentyl-3-phenyl-2,3-dihydroindol-1-yl]propan-1-one |
|---|---|
| PubChem CID | 102192645 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2,2-dimethyl-1-[(2S,3R)-2-pentyl-3-phenyl-2,3-dihydroindol-1-yl]propan-1-one |
| SMILES | CCCCC[C@H]1[C@H](c2ccccc2)c2ccccc2N1C(=O)C(C)(C)C |
| InChI | InChI=1S/C24H31NO/c1-5-6-8-17-21-22(18-13-9-7-10-14-18)19-15-11-12-16-20(19)25(21)23(26)24(2,3)4/h7,9-16,21-22H,5-6,8,17H2,1-4H3/t21-,22+/m0/s1 |
| InChIKey | RZGHCBRLVWFARJ-FCHUYYIVSA-N |
| XLogP | 6.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|