C15H23N — CID 163690232
(2R,3R)-1,3-dimethyl-2-pentyl-2,3-dihydroindole (PubChem CID 163690232) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (2R,3R)-1,3-dimethyl-2-pentyl-2,3-dihydroindole.
| Compound Name | (2R,3R)-1,3-dimethyl-2-pentyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 163690232 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (2R,3R)-1,3-dimethyl-2-pentyl-2,3-dihydroindole |
| SMILES | CCCCC[C@@H]1[C@H](C)c2ccccc2N1C |
| InChI | InChI=1S/C15H23N/c1-4-5-6-10-14-12(2)13-9-7-8-11-15(13)16(14)3/h7-9,11-12,14H,4-6,10H2,1-3H3/t12-,14-/m1/s1 |
| InChIKey | JSJDYSGPYHAJTD-TZMCWYRMSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|