C15H25N — CID 143458411
1-butyl-3-methyl-2,3-dihydroindole;ethane (PubChem CID 143458411) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 1-butyl-3-methyl-2,3-dihydroindole;ethane.
| Compound Name | 1-butyl-3-methyl-2,3-dihydroindole;ethane |
|---|---|
| PubChem CID | 143458411 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1-butyl-3-methyl-2,3-dihydroindole;ethane |
| SMILES | CC.CCCCN1CC(C)c2ccccc21 |
| InChI | InChI=1S/C13H19N.C2H6/c1-3-4-9-14-10-11(2)12-7-5-6-8-13(12)14;1-2/h5-8,11H,3-4,9-10H2,1-2H3;1-2H3 |
| InChIKey | OPZZEYVBKOUSOM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |