C19H32N2 — CID 114336060
1-nonyl-2,3,4,5-tetrahydro-1-benzazepin-5-amine (PubChem CID 114336060) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-nonyl-2,3,4,5-tetrahydro-1-benzazepin-5-amine.
| Compound Name | 1-nonyl-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
|---|---|
| PubChem CID | 114336060 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 1-nonyl-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
| SMILES | CCCCCCCCCN1CCCC(N)c2ccccc21 |
| InChI | InChI=1S/C19H32N2/c1-2-3-4-5-6-7-10-15-21-16-11-13-18(20)17-12-8-9-14-19(17)21/h8-9,12,14,18H,2-7,10-11,13,15-16,20H2,1H3 |
| InChIKey | GFSAXBMVEVXHTF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|