C15H24N2O — CID 114336160
1-(4-methoxybutyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine (PubChem CID 114336160) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(4-methoxybutyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine.
| Compound Name | 1-(4-methoxybutyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
|---|---|
| PubChem CID | 114336160 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-(4-methoxybutyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
| SMILES | COCCCCN1CCCC(N)c2ccccc21 |
| InChI | InChI=1S/C15H24N2O/c1-18-12-5-4-10-17-11-6-8-14(16)13-7-2-3-9-15(13)17/h2-3,7,9,14H,4-6,8,10-12,16H2,1H3 |
| InChIKey | MPZBQULCKPIFGL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|