C12H17NO2 — CID 114337638
1-(2-methoxyethyl)-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 114337638) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | 1-(2-methoxyethyl)-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 114337638 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-(2-methoxyethyl)-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | COCCN1CCC(O)c2ccccc21 |
| InChI | InChI=1S/C12H17NO2/c1-15-9-8-13-7-6-12(14)10-4-2-3-5-11(10)13/h2-5,12,14H,6-9H2,1H3 |
| InChIKey | BLWIUTKEZVDREC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |