C14H19NO — CID 114337665
1-pent-4-enyl-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 114337665) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-pent-4-enyl-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | 1-pent-4-enyl-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 114337665 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-pent-4-enyl-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | C=CCCCN1CCC(O)c2ccccc21 |
| InChI | InChI=1S/C14H19NO/c1-2-3-6-10-15-11-9-14(16)12-7-4-5-8-13(12)15/h2,4-5,7-8,14,16H,1,3,6,9-11H2 |
| InChIKey | IGRJYSAAYMJEGB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|