C13H19NOS — CID 114337590
1-(2-ethylsulfanylethyl)-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 114337590) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 1-(2-ethylsulfanylethyl)-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | 1-(2-ethylsulfanylethyl)-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 114337590 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(2-ethylsulfanylethyl)-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | CCSCCN1CCC(O)c2ccccc21 |
| InChI | InChI=1S/C13H19NOS/c1-2-16-10-9-14-8-7-13(15)11-5-3-4-6-12(11)14/h3-6,13,15H,2,7-10H2,1H3 |
| InChIKey | OPCVIKJQGACSKM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|