C11H12N2O — CID 114337618
2-(4-hydroxy-3,4-dihydro-2H-quinolin-1-yl)acetonitrile (PubChem CID 114337618) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(4-hydroxy-3,4-dihydro-2H-quinolin-1-yl)acetonitrile.
| Compound Name | 2-(4-hydroxy-3,4-dihydro-2H-quinolin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 114337618 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-(4-hydroxy-3,4-dihydro-2H-quinolin-1-yl)acetonitrile |
| SMILES | N#CCN1CCC(O)c2ccccc21 |
| InChI | InChI=1S/C11H12N2O/c12-6-8-13-7-5-11(14)9-3-1-2-4-10(9)13/h1-4,11,14H,5,7-8H2 |
| InChIKey | ODZADCVRIBIEER-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|