C19H24N2 — CID 114332852
1-(4-phenylbutyl)-3,4-dihydro-2H-quinolin-4-amine (PubChem CID 114332852) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-(4-phenylbutyl)-3,4-dihydro-2H-quinolin-4-amine.
| Compound Name | 1-(4-phenylbutyl)-3,4-dihydro-2H-quinolin-4-amine |
|---|---|
| PubChem CID | 114332852 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-(4-phenylbutyl)-3,4-dihydro-2H-quinolin-4-amine |
| SMILES | NC1CCN(CCCCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H24N2/c20-18-13-15-21(19-12-5-4-11-17(18)19)14-7-6-10-16-8-2-1-3-9-16/h1-5,8-9,11-12,18H,6-7,10,13-15,20H2 |
| InChIKey | ZNMALDIZSQEXQW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|