C14H26N2 — CID 142426417
ethane;1-methyl-3,4-dihydro-2H-quinolin-4-amine (PubChem CID 142426417) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;1-methyl-3,4-dihydro-2H-quinolin-4-amine.
| Compound Name | ethane;1-methyl-3,4-dihydro-2H-quinolin-4-amine |
|---|---|
| PubChem CID | 142426417 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;1-methyl-3,4-dihydro-2H-quinolin-4-amine |
| SMILES | CC.CC.CN1CCC(N)c2ccccc21 |
| InChI | InChI=1S/C10H14N2.2C2H6/c1-12-7-6-9(11)8-4-2-3-5-10(8)12;2*1-2/h2-5,9H,6-7,11H2,1H3;2*1-2H3 |
| InChIKey | JMEBZVYBVBEKGZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |