C11H15NO — CID 15531030
4-methoxy-1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 15531030) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-methoxy-1-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 4-methoxy-1-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 15531030 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-methoxy-1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | COC1CCN(C)c2ccccc21 |
| InChI | InChI=1S/C11H15NO/c1-12-8-7-11(13-2)9-5-3-4-6-10(9)12/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | XCUODCFJONVUBK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |