methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate

C12H15NO2 — CID 125044320

IUPACmethyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate
SMILESCOC(=O)[C@@H]1CCN(C)c2ccccc21
InChIInChI=1S/C12H15NO2/c1-13-8-7-10(12(14)15-2)9-5-3-4-6-11(9)13/h3-6,10H,7-8H2,1-2H3/t10-/m1/s1
InChIKeyXCPCJJNHYKJTCR-SNVBAGLBSA-N
MW205.26 g/mol
LogP1.78
Rot. Bonds1

About methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate

methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate (PubChem CID 125044320) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate.

Molecular Properties

Compound Namemethyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate
PubChem CID125044320
Molecular FormulaC12H15NO2
Molecular Weight205.26 g/mol
Exact Mass205.11
IUPAC Namemethyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate
SMILESCOC(=O)[C@@H]1CCN(C)c2ccccc21
InChIInChI=1S/C12H15NO2/c1-13-8-7-10(12(14)15-2)9-5-3-4-6-11(9)13/h3-6,10H,7-8H2,1-2H3/t10-/m1/s1
InChIKeyXCPCJJNHYKJTCR-SNVBAGLBSA-N
XLogP1.78
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.26
LogP ≤ 51.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate?
The IUPAC name of methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate (CID 125044320) is methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate.
What is the SMILES notation for methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate?
The canonical SMILES for methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate is COC(=O)[C@@H]1CCN(C)c2ccccc21.
What is the InChIKey of methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate?
The InChIKey is XCPCJJNHYKJTCR-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H15NO2/c1-13-8-7-10(12(14)15-2)9-5-3-4-6-11(9)13/h3-6,10H,7-8H2,1-2H3/t10-/m1/s1.
What are the key properties of methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate?
methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate has a molecular weight of 205.26 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4R)-1-methyl-3,4-dihydro-2H-quinoline-4-carboxylate is sourced from PubChem (CID 125044320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).