C9H12N2 — CID 175654020
(3R)-1-methyl-2,3-dihydroindol-3-amine (PubChem CID 175654020) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (3R)-1-methyl-2,3-dihydroindol-3-amine.
| Compound Name | (3R)-1-methyl-2,3-dihydroindol-3-amine |
|---|---|
| PubChem CID | 175654020 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (3R)-1-methyl-2,3-dihydroindol-3-amine |
| SMILES | CN1C[C@H](N)c2ccccc21 |
| InChI | InChI=1S/C9H12N2/c1-11-6-8(10)7-4-2-3-5-9(7)11/h2-5,8H,6,10H2,1H3/t8-/m0/s1 |
| InChIKey | YEXAFGLRWSJJSF-QMMMGPOBSA-N |
| XLogP | 1.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |