C13H20N2 — CID 115106432
N-methyl-3-(1-methyl-2,3-dihydroindol-3-yl)propan-1-amine (PubChem CID 115106432) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-methyl-3-(1-methyl-2,3-dihydroindol-3-yl)propan-1-amine.
| Compound Name | N-methyl-3-(1-methyl-2,3-dihydroindol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 115106432 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-methyl-3-(1-methyl-2,3-dihydroindol-3-yl)propan-1-amine |
| SMILES | CNCCCC1CN(C)c2ccccc21 |
| InChI | InChI=1S/C13H20N2/c1-14-9-5-6-11-10-15(2)13-8-4-3-7-12(11)13/h3-4,7-8,11,14H,5-6,9-10H2,1-2H3 |
| InChIKey | ZQQBBUVTZPBAGT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|