C10H13N — CID 126732143
(3S)-1,3-dimethyl-2,3-dihydroindole (PubChem CID 126732143) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (3S)-1,3-dimethyl-2,3-dihydroindole.
| Compound Name | (3S)-1,3-dimethyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 126732143 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (3S)-1,3-dimethyl-2,3-dihydroindole |
| SMILES | C[C@@H]1CN(C)c2ccccc21 |
| InChI | InChI=1S/C10H13N/c1-8-7-11(2)10-6-4-3-5-9(8)10/h3-6,8H,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | MNNJPINCYKGTNO-MRVPVSSYSA-N |
| XLogP | 2.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |