C9H11NS — CID 123600877
1-methyl-2,3-dihydroindole-3-thiol (PubChem CID 123600877) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 1-methyl-2,3-dihydroindole-3-thiol.
| Compound Name | 1-methyl-2,3-dihydroindole-3-thiol |
|---|---|
| PubChem CID | 123600877 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 1-methyl-2,3-dihydroindole-3-thiol |
| SMILES | CN1CC(S)c2ccccc21 |
| InChI | InChI=1S/C9H11NS/c1-10-6-9(11)7-4-2-3-5-8(7)10/h2-5,9,11H,6H2,1H3 |
| InChIKey | HVWQWMFKMBNHOL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|