C11H16N2 — CID 82647084
1,5-dimethyl-2,3,4,5-tetrahydro-1,4-benzodiazepine (PubChem CID 82647084) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,5-dimethyl-2,3,4,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 1,5-dimethyl-2,3,4,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 82647084 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,5-dimethyl-2,3,4,5-tetrahydro-1,4-benzodiazepine |
| SMILES | CC1NCCN(C)c2ccccc21 |
| InChI | InChI=1S/C11H16N2/c1-9-10-5-3-4-6-11(10)13(2)8-7-12-9/h3-6,9,12H,7-8H2,1-2H3 |
| InChIKey | ZYELXCVRTYNGPQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |