C14H20N2O — CID 66875825
4-(1-methyl-1,2,3,4-tetrahydroisoquinolin-5-yl)morpholine (PubChem CID 66875825) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 4-(1-methyl-1,2,3,4-tetrahydroisoquinolin-5-yl)morpholine.
| Compound Name | 4-(1-methyl-1,2,3,4-tetrahydroisoquinolin-5-yl)morpholine |
|---|---|
| PubChem CID | 66875825 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 4-(1-methyl-1,2,3,4-tetrahydroisoquinolin-5-yl)morpholine |
| SMILES | CC1NCCc2c1cccc2N1CCOCC1 |
| InChI | InChI=1S/C14H20N2O/c1-11-12-3-2-4-14(13(12)5-6-15-11)16-7-9-17-10-8-16/h2-4,11,15H,5-10H2,1H3 |
| InChIKey | UBXZMNYMSOEDNU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |