C8H18N2O — CID 163399035
1,3-dimethylpiperazin-2-one;ethane (PubChem CID 163399035) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 1,3-dimethylpiperazin-2-one;ethane.
| Compound Name | 1,3-dimethylpiperazin-2-one;ethane |
|---|---|
| PubChem CID | 163399035 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 1,3-dimethylpiperazin-2-one;ethane |
| SMILES | CC.CC1NCCN(C)C1=O |
| InChI | InChI=1S/C6H12N2O.C2H6/c1-5-6(9)8(2)4-3-7-5;1-2/h5,7H,3-4H2,1-2H3;1-2H3 |
| InChIKey | PHHIKMOFJNTALQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |