C16H25N — CID 154324891
1-heptyl-3,4-dihydro-2H-quinoline (PubChem CID 154324891) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 1-heptyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-heptyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 154324891 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 1-heptyl-3,4-dihydro-2H-quinoline |
| SMILES | CCCCCCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C16H25N/c1-2-3-4-5-8-13-17-14-9-11-15-10-6-7-12-16(15)17/h6-7,10,12H,2-5,8-9,11,13-14H2,1H3 |
| InChIKey | QXGNTPVJUHNYEJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|