C17H28N2 — CID 13472124
6-(3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethylhexan-1-amine (PubChem CID 13472124) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethylhexan-1-amine.
| Compound Name | 6-(3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 13472124 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 6-(3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethylhexan-1-amine |
| SMILES | CN(C)CCCCCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C17H28N2/c1-18(2)13-7-3-4-8-14-19-15-9-11-16-10-5-6-12-17(16)19/h5-6,10,12H,3-4,7-9,11,13-15H2,1-2H3 |
| InChIKey | LGYCBDAAPOWWRT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|