C19H32N2 — CID 13472133
8-(3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethyloctan-1-amine (PubChem CID 13472133) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 8-(3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethyloctan-1-amine.
| Compound Name | 8-(3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethyloctan-1-amine |
|---|---|
| PubChem CID | 13472133 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 8-(3,4-dihydro-2H-quinolin-1-yl)-N,N-dimethyloctan-1-amine |
| SMILES | CN(C)CCCCCCCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C19H32N2/c1-20(2)15-9-5-3-4-6-10-16-21-17-11-13-18-12-7-8-14-19(18)21/h7-8,12,14H,3-6,9-11,13,15-17H2,1-2H3 |
| InChIKey | HHQYGWVATIQRCQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|