C14H22N2 — CID 60840995
4-(3,4-dihydro-2H-quinolin-1-yl)-N-methylbutan-1-amine (PubChem CID 60840995) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-yl)-N-methylbutan-1-amine.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 60840995 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-N-methylbutan-1-amine |
| SMILES | CNCCCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C14H22N2/c1-15-10-4-5-11-16-12-6-8-13-7-2-3-9-14(13)16/h2-3,7,9,15H,4-6,8,10-12H2,1H3 |
| InChIKey | BNUDXDVMURWWIR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|