C15H24INO — CID 13300508
1-hexyl-3,4-dihydro-2H-quinolin-6-ol;hydroiodide (PubChem CID 13300508) has the molecular formula C15H24INO and a molecular weight of 361.27 g/mol. Its IUPAC name is 1-hexyl-3,4-dihydro-2H-quinolin-6-ol;hydroiodide.
| Compound Name | 1-hexyl-3,4-dihydro-2H-quinolin-6-ol;hydroiodide |
|---|---|
| PubChem CID | 13300508 |
| Molecular Formula | C15H24INO |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-hexyl-3,4-dihydro-2H-quinolin-6-ol;hydroiodide |
| SMILES | CCCCCCN1CCCc2cc(O)ccc21.I |
| InChI | InChI=1S/C15H23NO.HI/c1-2-3-4-5-10-16-11-6-7-13-12-14(17)8-9-15(13)16;/h8-9,12,17H,2-7,10-11H2,1H3;1H |
| InChIKey | HREAWJLNYZOULQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|