C15H24N2O — CID 107704010
6-(6-amino-3,4-dihydro-2H-quinolin-1-yl)hexan-1-ol (PubChem CID 107704010) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 6-(6-amino-3,4-dihydro-2H-quinolin-1-yl)hexan-1-ol.
| Compound Name | 6-(6-amino-3,4-dihydro-2H-quinolin-1-yl)hexan-1-ol |
|---|---|
| PubChem CID | 107704010 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 6-(6-amino-3,4-dihydro-2H-quinolin-1-yl)hexan-1-ol |
| SMILES | Nc1ccc2c(c1)CCCN2CCCCCCO |
| InChI | InChI=1S/C15H24N2O/c16-14-7-8-15-13(12-14)6-5-10-17(15)9-3-1-2-4-11-18/h7-8,12,18H,1-6,9-11,16H2 |
| InChIKey | ASERXNWHXRDHEB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|