C14H19F2NO2 — CID 110931720
4-[6-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]butan-1-ol (PubChem CID 110931720) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 4-[6-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]butan-1-ol.
| Compound Name | 4-[6-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 110931720 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 4-[6-(difluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]butan-1-ol |
| SMILES | OCCCCN1CCCc2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C14H19F2NO2/c15-14(16)19-12-5-6-13-11(10-12)4-3-8-17(13)7-1-2-9-18/h5-6,10,14,18H,1-4,7-9H2 |
| InChIKey | MNXOJJWILGBARI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|