C11H12F2O — CID 82076236
6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 82076236) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is 6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 82076236 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | FC(F)Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C11H12F2O/c12-11(13)14-10-6-5-8-3-1-2-4-9(8)7-10/h5-7,11H,1-4H2 |
| InChIKey | YSFIIJMWCQWGJL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |