C9H8F2O2 — CID 177206683
6-(difluoromethoxy)-2,3-dihydro-1-benzofuran (PubChem CID 177206683) has the molecular formula C9H8F2O2 and a molecular weight of 186.16 g/mol. Its IUPAC name is 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran.
| Compound Name | 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 177206683 |
| Molecular Formula | C9H8F2O2 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 6-(difluoromethoxy)-2,3-dihydro-1-benzofuran |
| SMILES | FC(F)Oc1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C9H8F2O2/c10-9(11)13-7-2-1-6-3-4-12-8(6)5-7/h1-2,5,9H,3-4H2 |
| InChIKey | KGOLIYRVZPISIF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |