C10H7BrF2O3 — CID 177204677
(3R)-3-bromo-7-(difluoromethoxy)-2,3-dihydrochromen-4-one (PubChem CID 177204677) has the molecular formula C10H7BrF2O3 and a molecular weight of 293.06 g/mol. Its IUPAC name is (3R)-3-bromo-7-(difluoromethoxy)-2,3-dihydrochromen-4-one.
| Compound Name | (3R)-3-bromo-7-(difluoromethoxy)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 177204677 |
| Molecular Formula | C10H7BrF2O3 |
| Molecular Weight | 293.06 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | (3R)-3-bromo-7-(difluoromethoxy)-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2ccc(OC(F)F)cc2OC[C@H]1Br |
| InChI | InChI=1S/C10H7BrF2O3/c11-7-4-15-8-3-5(16-10(12)13)1-2-6(8)9(7)14/h1-3,7,10H,4H2/t7-/m1/s1 |
| InChIKey | VERJZAXGBSAEGU-SSDOTTSWSA-N |
| XLogP | 2.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.06 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|