C10H9BrF2O3 — CID 177204858
(3R,4R)-3-bromo-7-(difluoromethoxy)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 177204858) has the molecular formula C10H9BrF2O3 and a molecular weight of 295.08 g/mol. Its IUPAC name is (3R,4R)-3-bromo-7-(difluoromethoxy)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (3R,4R)-3-bromo-7-(difluoromethoxy)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 177204858 |
| Molecular Formula | C10H9BrF2O3 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | (3R,4R)-3-bromo-7-(difluoromethoxy)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@@H]1c2ccc(OC(F)F)cc2OC[C@H]1Br |
| InChI | InChI=1S/C10H9BrF2O3/c11-7-4-15-8-3-5(16-10(12)13)1-2-6(8)9(7)14/h1-3,7,9-10,14H,4H2/t7-,9-/m1/s1 |
| InChIKey | ZEAOVKZWFUJFHR-VXNVDRBHSA-N |
| XLogP | 2.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|