About 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide
2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide (PubChem CID 63097258) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide.
Molecular Properties
| Compound Name | 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide |
| PubChem CID | 63097258 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide |
| SMILES | CCC(Oc1ccc2c(c1)OCC2N)C(N)=O |
| InChI | InChI=1S/C12H16N2O3/c1-2-10(12(14)15)17-7-3-4-8-9(13)6-16-11(8)5-7/h3-5,9-10H,2,6,13H2,1H3,(H2,14,15) |
| InChIKey | VZUKKFQWUOJRQJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide?
The IUPAC name of 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide (CID 63097258) is 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide.
What is the SMILES notation for 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide?
The canonical SMILES for 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide is CCC(Oc1ccc2c(c1)OCC2N)C(N)=O.
What is the InChIKey of 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide?
The InChIKey is VZUKKFQWUOJRQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3/c1-2-10(12(14)15)17-7-3-4-8-9(13)6-16-11(8)5-7/h3-5,9-10H,2,6,13H2,1H3,(H2,14,15).
What are the key properties of 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide?
2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide has a molecular weight of 236.27 g/mol, XLogP of 0.72, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-amino-2,3-dihydro-1-benzofuran-6-yl)oxy]butanamide is sourced from PubChem (CID 63097258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).