About 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane
2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane (PubChem CID 164867478) has the molecular formula C8H7F5OS
and a molecular weight of 246.20 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane.
Analyze 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane?
The IUPAC name of 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane (CID 164867478) is 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane.
What is the SMILES notation for 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane?
The canonical SMILES for 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane is FS(F)(F)(F)(F)c1ccc2c(c1)OCC2.
What is the InChIKey of 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane?
The InChIKey is FGZSQMTYAMTCND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F5OS/c9-15(10,11,12,13)7-2-1-6-3-4-14-8(6)5-7/h1-2,5H,3-4H2.
What are the key properties of 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane?
2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane has a molecular weight of 246.20 g/mol, XLogP of 4.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1-benzofuran-6-yl(pentafluoro)-λ6-sulfane is sourced from PubChem (CID 164867478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).