C11H12O2S — CID 131076574
3-(2,3-dihydro-1-benzofuran-6-yl)thietan-3-ol (PubChem CID 131076574) has the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-6-yl)thietan-3-ol.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-6-yl)thietan-3-ol |
|---|---|
| PubChem CID | 131076574 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-6-yl)thietan-3-ol |
| SMILES | OC1(c2ccc3c(c2)OCC3)CSC1 |
| InChI | InChI=1S/C11H12O2S/c12-11(6-14-7-11)9-2-1-8-3-4-13-10(8)5-9/h1-2,5,12H,3-4,6-7H2 |
| InChIKey | UQMMKJCYUXNFOE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |