C16H22O3 — CID 104542076
4-(2,3-dihydro-1-benzofuran-5-yl)-2-propan-2-yloxan-4-ol (PubChem CID 104542076) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-5-yl)-2-propan-2-yloxan-4-ol.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-5-yl)-2-propan-2-yloxan-4-ol |
|---|---|
| PubChem CID | 104542076 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-5-yl)-2-propan-2-yloxan-4-ol |
| SMILES | CC(C)C1CC(O)(c2ccc3c(c2)CCO3)CCO1 |
| InChI | InChI=1S/C16H22O3/c1-11(2)15-10-16(17,6-8-19-15)13-3-4-14-12(9-13)5-7-18-14/h3-4,9,11,15,17H,5-8,10H2,1-2H3 |
| InChIKey | JIPMTDCRGSICFA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |