C13H16O2 — CID 103564717
1-(2,3-dihydro-1-benzofuran-5-yl)-3-methylcyclobutan-1-ol (PubChem CID 103564717) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-3-methylcyclobutan-1-ol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-3-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 103564717 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-3-methylcyclobutan-1-ol |
| SMILES | CC1CC(O)(c2ccc3c(c2)CCO3)C1 |
| InChI | InChI=1S/C13H16O2/c1-9-7-13(14,8-9)11-2-3-12-10(6-11)4-5-15-12/h2-3,6,9,14H,4-5,7-8H2,1H3 |
| InChIKey | WMBQYKBFFXLCLZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |